Compound Angles0%

Trigonometry · Topic 8 of 19

Compound Angles

Video lesson · from 34:463 worked examples

One lesson video covers all of Trigonometry, so it opens at 34:46 for this topic — not from the beginning.

Theory

Compound angles are formed by adding or subtracting angles, for example 45+30=7545^\circ + 30^\circ = 75^\circ or 4530=1545^\circ - 30^\circ = 15^\circ.

Note that sin(A+B)sinA+sinB\sin(A + B) \neq \sin A + \sin B. You can verify this by checking that sin(45+30)\sin(45^\circ + 30^\circ) and sin45+sin30\sin 45^\circ + \sin 30^\circ give different answers.

Addition Formulae

sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A \cos B \pm \cos A \sin B
cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A \cos B \mp \sin A \sin B

Notice how the signs work: sine keeps the same sign (±±\pm \to \pm) while cosine flips the sign (±\pm \to \mp).

⚠️ Common Examiner Traps

  • The signs behave differently: cos(A+B)=cosAcosBsinAsinB\cos(A+B) = \cos A\cos B - \sin A\sin B — the sign flips for cosine but matches for sine. Mixing these up is the most common compound-angle error.
  • Do not distribute: sin(A+B)\sin(A+B) is not sinA+sinB\sin A + \sin B. The formula exists precisely because that shortcut is false.
  • Choose angles that give exact values: for 7575^\circ use 45+3045^\circ + 30^\circ — both have exact values you know.
  • Keep it exact: in a non-calculator question the answer should be a surd, not a decimal.

Worked examples

Example 1

Expand and simplify cos(x+60)\cos(x + 60^\circ).

cos(x+60)=cosxcos60sinxsin60=cosx(12)sinx(32)=12cosx32sinx\begin{aligned} \cos(x + 60^\circ) &= \cos x \cos 60^\circ - \sin x \sin 60^\circ \\ &= \cos x \cdot \left(\frac{1}{2}\right) - \sin x \cdot \left(\frac{\sqrt{3}}{2}\right) \\ &= \frac{1}{2}\cos x - \frac{\sqrt{3}}{2}\sin x \end{aligned}

Example 2

Show that sin(a+b)=sinacosb+cosasinb\sin(a + b) = \sin a \cos b + \cos a \sin b for a=π6a = \frac{\pi}{6} and b=π3b = \frac{\pi}{3}.

LHS (Left Hand Side):

sin(π6+π3)=sin(π6+2π6)=sin(3π6)=sin(π2)=1\begin{aligned} \sin\left(\frac{\pi}{6} + \frac{\pi}{3}\right) &= \sin\left(\frac{\pi}{6} + \frac{2\pi}{6}\right) \\ &= \sin\left(\frac{3\pi}{6}\right) \\ &= \sin\left(\frac{\pi}{2}\right) \\ &= 1 \end{aligned}

RHS (Right Hand Side):

sin(π6)cos(π3)+cos(π6)sin(π3)=(12)(12)+(32)(32)=14+34=44=1\begin{aligned} &\quad \sin\left(\frac{\pi}{6}\right) \cos\left(\frac{\pi}{3}\right) + \cos\left(\frac{\pi}{6}\right) \sin\left(\frac{\pi}{3}\right) \\ &= \left(\frac{1}{2}\right)\left(\frac{1}{2}\right) + \left(\frac{\sqrt{3}}{2}\right)\left(\frac{\sqrt{3}}{2}\right) \\ &= \frac{1}{4} + \frac{3}{4} \\ &= \frac{4}{4} \\ &= 1 \end{aligned}

LHS = RHS. As required.

Example 3

Find the exact value of sin75\sin 75^\circ.

We can write 7575^\circ as 45+3045^\circ + 30^\circ to use exact values we know.

sin75=sin(45+30)=sin45cos30+cos45sin30=(12)(32)+(12)(12)=322+122=3+122\begin{aligned} \sin 75^\circ &= \sin(45^\circ + 30^\circ) \\ &= \sin 45^\circ \cos 30^\circ + \cos 45^\circ \sin 30^\circ \\ &= \left(\frac{1}{\sqrt{2}}\right)\left(\frac{\sqrt{3}}{2}\right) + \left(\frac{1}{\sqrt{2}}\right)\left(\frac{1}{2}\right) \\ &= \frac{\sqrt{3}}{2\sqrt{2}} + \frac{1}{2\sqrt{2}} \\ &= \frac{\sqrt{3} + 1}{2\sqrt{2}} \end{aligned}