Double Angle Formulae0%

Trigonometry · Topic 10 of 19

Double Angle Formulae

Video lesson · from 40:104 worked examples

One lesson video covers all of Trigonometry, so it opens at 40:10 for this topic — not from the beginning.

Theory

We can derive the Double Angle Formulae by replacing BB with AA in our addition formulae.

Double Angle Formulae

sin2A=2sinAcosA\sin 2A = 2\sin A\cos A
cos2A=cos2Asin2A=2cos2A1=12sin2A\begin{aligned} \cos 2A &= \cos^2 A - \sin^2 A \\ &= 2\cos^2 A - 1 \\ &= 1 - 2\sin^2 A \end{aligned}

The three versions of the cos2A\cos 2A formula are derived using the National 5 identity sin2A+cos2A=1\sin^2 A + \cos^2 A = 1.

⚠️ Common Examiner Traps

  • sin2x\sin 2x is not 2sinx2\sin x: it is 2sinxcosx2\sin x\cos x. The same applies to cosine — doubling the angle is not doubling the function.
  • Three versions of cos2x\cos 2x: pick the one that leaves the equation in a single trig function. Choosing badly turns an easy question into a hard one.
  • The formulae work both ways: you may need to replace 2sinxcosx2\sin x\cos x with sin2x\sin 2x to simplify an expression.
  • They apply to any doubled angle: sin4x=2sin2xcos2x\sin 4x = 2\sin 2x\cos 2x, not just 2x2x.

Worked examples

Example 1

a) Write down the formula for sin2x\sin 2x.
b) Write down the formula for sin6x\sin 6x.

a) sin2x=2sinxcosx\sin 2x = 2\sin x \cos x

b) We can treat 6x6x as double 3x3x. Let A=3xA = 3x:

sin6x=2sin3xcos3x\sin 6x = 2\sin 3x \cos 3x

Example 2

Simplify cos2(π6)sin2(π6)\cos^2\left(\frac{\pi}{6}\right) - \sin^2\left(\frac{\pi}{6}\right).

This matches the structure of cos2Asin2A=cos2A\cos^2 A - \sin^2 A = \cos 2A, where A=π6A = \frac{\pi}{6}.

cos2(π6)sin2(π6)=cos(2(π6))=cos(2π6)=cos(π3)=12\begin{aligned} \cos^2\left(\frac{\pi}{6}\right) - \sin^2\left(\frac{\pi}{6}\right) &= \cos\left(2\left(\frac{\pi}{6}\right)\right) \\ &= \cos\left(\frac{2\pi}{6}\right) \\ &= \cos\left(\frac{\pi}{3}\right) \\ &= \frac{1}{2} \end{aligned}

Example 3

If tanp=43\tan p = \frac{4}{3} for acute angle pp, find the exact values of sin2p\sin 2p and cos2p\cos 2p.

First, set up a right-angled triangle with Opposite = 4, Adjacent = 3.

Hypotenuse = 42+32=16+9=25=5\sqrt{4^2 + 3^2} = \sqrt{16 + 9} = \sqrt{25} = 5.

Therefore, sinp=45\sin p = \frac{4}{5} and cosp=35\cos p = \frac{3}{5}.

sin2p=2sinpcosp=2(45)(35)=2425\begin{aligned} \sin 2p &= 2\sin p \cos p \\ &= 2\left(\frac{4}{5}\right)\left(\frac{3}{5}\right) \\ &= \frac{24}{25} \end{aligned}

You can use any of the three cos2A\cos 2A formulae. Let's use cos2Asin2A\cos^2 A - \sin^2 A:

cos2p=cos2psin2p=(35)2(45)2=9251625=725\begin{aligned} \cos 2p &= \cos^2 p - \sin^2 p \\ &= \left(\frac{3}{5}\right)^2 - \left(\frac{4}{5}\right)^2 \\ &= \frac{9}{25} - \frac{16}{25} \\ &= -\frac{7}{25} \end{aligned}

Example 4

Given that cos2x=513\cos 2x = \frac{5}{13}, find the exact values of sinx\sin x and cosx\cos x (assume xx is acute).

Use the double angle formulae that only contain one term:

To find cosx\cos x:

2cos2x1=5132cos2x=1813cos2x=913cosx=313\begin{aligned} 2\cos^2 x - 1 &= \frac{5}{13} \\ 2\cos^2 x &= \frac{18}{13} \\ \cos^2 x &= \frac{9}{13} \\ \cos x &= \frac{3}{\sqrt{13}} \end{aligned}

To find sinx\sin x:

12sin2x=5132sin2x=813sin2x=413sinx=213\begin{aligned} 1 - 2\sin^2 x &= \frac{5}{13} \\ 2\sin^2 x &= \frac{8}{13} \\ \sin^2 x &= \frac{4}{13} \\ \sin x &= \frac{2}{\sqrt{13}} \end{aligned}